C27H10Cl4I4O5 — CID 14534555
benzyl 2,3,4,5-tetrachloro-6-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoate (PubChem CID 14534555) has the molecular formula C27H10Cl4I4O5 and a molecular weight of 1063.80 g/mol. Its IUPAC name is benzyl 2,3,4,5-tetrachloro-6-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoate.
| Compound Name | benzyl 2,3,4,5-tetrachloro-6-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoate |
|---|---|
| PubChem CID | 14534555 |
| Molecular Formula | C27H10Cl4I4O5 |
| Molecular Weight | 1063.80 g/mol |
| Exact Mass | 1061.55 |
| IUPAC Name | benzyl 2,3,4,5-tetrachloro-6-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzoate |
| SMILES | O=C(OCc1ccccc1)c1c(Cl)c(Cl)c(Cl)c(Cl)c1-c1c2cc(I)c(=O)c(I)c-2oc2c(I)c(O)c(I)cc12 |
| InChI | InChI=1S/C27H10Cl4I4O5/c28-17-15(16(18(29)20(31)19(17)30)27(38)39-8-9-4-2-1-3-5-9)14-10-6-12(32)23(36)21(34)25(10)40-26-11(14)7-13(33)24(37)22(26)35/h1-7,36H,8H2 |
| InChIKey | MNYWUVSICFRRCX-UHFFFAOYSA-N |
| XLogP | 10.66 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1063.80 |
| LogP ≤ 5 | 10.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|