C19H4Cl4I4O3 — CID 14534565
6-hydroxy-2,4,5,7-tetraiodo-9-(2,3,4,5-tetrachlorophenyl)xanthen-3-one (PubChem CID 14534565) has the molecular formula C19H4Cl4I4O3 and a molecular weight of 929.67 g/mol. Its IUPAC name is 6-hydroxy-2,4,5,7-tetraiodo-9-(2,3,4,5-tetrachlorophenyl)xanthen-3-one.
| Compound Name | 6-hydroxy-2,4,5,7-tetraiodo-9-(2,3,4,5-tetrachlorophenyl)xanthen-3-one |
|---|---|
| PubChem CID | 14534565 |
| Molecular Formula | C19H4Cl4I4O3 |
| Molecular Weight | 929.67 g/mol |
| Exact Mass | 927.51 |
| IUPAC Name | 6-hydroxy-2,4,5,7-tetraiodo-9-(2,3,4,5-tetrachlorophenyl)xanthen-3-one |
| SMILES | O=c1c(I)cc2c(-c3cc(Cl)c(Cl)c(Cl)c3Cl)c3cc(I)c(O)c(I)c3oc-2c1I |
| InChI | InChI=1S/C19H4Cl4I4O3/c20-7-1-4(11(21)13(23)12(7)22)10-5-2-8(24)16(28)14(26)18(5)30-19-6(10)3-9(25)17(29)15(19)27/h1-3,28H |
| InChIKey | PHLKQCKGXJMOMM-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 929.67 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|