C19H30 — CID 145345723
5-(5-prop-1-en-2-yldec-9-en-5-yl)cyclohexa-1,3-diene (PubChem CID 145345723) has the molecular formula C19H30 and a molecular weight of 258.45 g/mol. Its IUPAC name is 5-(5-prop-1-en-2-yldec-9-en-5-yl)cyclohexa-1,3-diene.
| Compound Name | 5-(5-prop-1-en-2-yldec-9-en-5-yl)cyclohexa-1,3-diene |
|---|---|
| PubChem CID | 145345723 |
| Molecular Formula | C19H30 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 5-(5-prop-1-en-2-yldec-9-en-5-yl)cyclohexa-1,3-diene |
| SMILES | C=CCCCC(CCCC)(C(=C)C)C1C=CC=CC1 |
| InChI | InChI=1S/C19H30/c1-5-7-12-16-19(17(3)4,15-8-6-2)18-13-10-9-11-14-18/h5,9-11,13,18H,1,3,6-8,12,14-16H2,2,4H3 |
| InChIKey | NCSSYFBBFIIWIB-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|