C21H26FNO3 — CID 145346290
[(2E)-2-ethenylpenta-2,4-dienyl] (E)-3-[4-[ethyl(2-methoxyethyl)amino]-3-fluorophenyl]prop-2-enoate (PubChem CID 145346290) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] (E)-3-[4-[ethyl(2-methoxyethyl)amino]-3-fluorophenyl]prop-2-enoate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] (E)-3-[4-[ethyl(2-methoxyethyl)amino]-3-fluorophenyl]prop-2-enoate |
|---|---|
| PubChem CID | 145346290 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] (E)-3-[4-[ethyl(2-methoxyethyl)amino]-3-fluorophenyl]prop-2-enoate |
| SMILES | C=C/C=C(\C=C)COC(=O)/C=C/c1ccc(N(CC)CCOC)c(F)c1 |
| InChI | InChI=1S/C21H26FNO3/c1-5-8-17(6-2)16-26-21(24)12-10-18-9-11-20(19(22)15-18)23(7-3)13-14-25-4/h5-6,8-12,15H,1-2,7,13-14,16H2,3-4H3/b12-10+,17-8+ |
| InChIKey | TUPXMPSBZWJQIN-DIKASIRLSA-N |
| XLogP | 4.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|