C12H15N3O2 — CID 145346928
N-(2-methoxyprop-2-enyl)-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide (PubChem CID 145346928) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-(2-methoxyprop-2-enyl)-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide.
| Compound Name | N-(2-methoxyprop-2-enyl)-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 145346928 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | N-(2-methoxyprop-2-enyl)-1,3-dihydropyrrolo[3,4-c]pyridine-2-carboxamide |
| SMILES | C=C(CNC(=O)N1Cc2ccncc2C1)OC |
| InChI | InChI=1S/C12H15N3O2/c1-9(17-2)5-14-12(16)15-7-10-3-4-13-6-11(10)8-15/h3-4,6H,1,5,7-8H2,2H3,(H,14,16) |
| InChIKey | DVGJWYFXRSQEDU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|