C21H16F6N4O2 — CID 145347131
(E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-pyrimidin-5-ylprop-2-enoic acid;ethane (PubChem CID 145347131) has the molecular formula C21H16F6N4O2 and a molecular weight of 470.37 g/mol. Its IUPAC name is (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-pyrimidin-5-ylprop-2-enoic acid;ethane.
| Compound Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-pyrimidin-5-ylprop-2-enoic acid;ethane |
|---|---|
| PubChem CID | 145347131 |
| Molecular Formula | C21H16F6N4O2 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 470.12 |
| IUPAC Name | (E)-3-[2-[3,5-bis(trifluoromethyl)phenyl]pyrimidin-4-yl]-2-pyrimidin-5-ylprop-2-enoic acid;ethane |
| SMILES | CC.O=C(O)/C(=C/c1ccnc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)n1)c1cncnc1 |
| InChI | InChI=1S/C19H10F6N4O2.C2H6/c20-18(21,22)12-3-10(4-13(5-12)19(23,24)25)16-28-2-1-14(29-16)6-15(17(30)31)11-7-26-9-27-8-11;1-2/h1-9H,(H,30,31);1-2H3/b15-6+; |
| InChIKey | PKMSEPAKLGLFHZ-AWXXIEIHSA-N |
| XLogP | 5.62 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|