About [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium
[(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium (PubChem CID 145347303) has the molecular formula C5H8F3N2+
and a molecular weight of 153.13 g/mol. Its IUPAC name is [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium.
Molecular Properties
| Compound Name | [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium |
| PubChem CID | 145347303 |
| Molecular Formula | C5H8F3N2+ |
| Molecular Weight | 153.13 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium |
| SMILES | CC(=[NH2+])/C=C(\N)C(F)(F)F |
| InChI | InChI=1S/C5H7F3N2/c1-3(9)2-4(10)5(6,7)8/h2,9H,10H2,1H3/p+1/b4-2-,9-3? |
| InChIKey | NOTGUFNPRKWNBT-UPMVQODRSA-O |
| XLogP | -0.39 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.13 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium?
The IUPAC name of [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium (CID 145347303) is [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium.
What is the SMILES notation for [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium?
The canonical SMILES for [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium is CC(=[NH2+])/C=C(\N)C(F)(F)F.
What is the InChIKey of [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium?
The InChIKey is NOTGUFNPRKWNBT-UPMVQODRSA-O. The full InChI is InChI=1S/C5H7F3N2/c1-3(9)2-4(10)5(6,7)8/h2,9H,10H2,1H3/p+1/b4-2-,9-3?.
What are the key properties of [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium?
[(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium has a molecular weight of 153.13 g/mol, XLogP of -0.39, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-4-amino-5,5,5-trifluoropent-3-en-2-ylidene]azanium is sourced from PubChem (CID 145347303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).