About (3Z,5Z)-2,7-dihydro-1H-2-benzazonine
(3Z,5Z)-2,7-dihydro-1H-2-benzazonine (PubChem CID 145347760) has the molecular formula C12H13N
and a molecular weight of 171.24 g/mol. Its IUPAC name is (3Z,5Z)-2,7-dihydro-1H-2-benzazonine.
Molecular Properties
| Compound Name | (3Z,5Z)-2,7-dihydro-1H-2-benzazonine |
| PubChem CID | 145347760 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (3Z,5Z)-2,7-dihydro-1H-2-benzazonine |
| SMILES | C1=C\Cc2ccccc2CN\C=C/1 |
| InChI | InChI=1S/C12H13N/c1-2-6-11-7-3-4-8-12(11)10-13-9-5-1/h1-5,7-9,13H,6,10H2/b2-1-,9-5- |
| InChIKey | KWQUEIXWCHCABV-HBRSPCJUSA-N |
| XLogP | 2.40 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3Z,5Z)-2,7-dihydro-1H-2-benzazonine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-2,7-dihydro-1H-2-benzazonine?
The IUPAC name of (3Z,5Z)-2,7-dihydro-1H-2-benzazonine (CID 145347760) is (3Z,5Z)-2,7-dihydro-1H-2-benzazonine.
What is the SMILES notation for (3Z,5Z)-2,7-dihydro-1H-2-benzazonine?
The canonical SMILES for (3Z,5Z)-2,7-dihydro-1H-2-benzazonine is C1=C\Cc2ccccc2CN\C=C/1.
What is the InChIKey of (3Z,5Z)-2,7-dihydro-1H-2-benzazonine?
The InChIKey is KWQUEIXWCHCABV-HBRSPCJUSA-N. The full InChI is InChI=1S/C12H13N/c1-2-6-11-7-3-4-8-12(11)10-13-9-5-1/h1-5,7-9,13H,6,10H2/b2-1-,9-5-.
What are the key properties of (3Z,5Z)-2,7-dihydro-1H-2-benzazonine?
(3Z,5Z)-2,7-dihydro-1H-2-benzazonine has a molecular weight of 171.24 g/mol, XLogP of 2.40, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-2,7-dihydro-1H-2-benzazonine is sourced from PubChem (CID 145347760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).