C34H37N — CID 145348013
3,6-ditert-butyl-9-[4-[(3-methylphenyl)methyl]phenyl]carbazole (PubChem CID 145348013) has the molecular formula C34H37N and a molecular weight of 459.68 g/mol. Its IUPAC name is 3,6-ditert-butyl-9-[4-[(3-methylphenyl)methyl]phenyl]carbazole.
| Compound Name | 3,6-ditert-butyl-9-[4-[(3-methylphenyl)methyl]phenyl]carbazole |
|---|---|
| PubChem CID | 145348013 |
| Molecular Formula | C34H37N |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.29 |
| IUPAC Name | 3,6-ditert-butyl-9-[4-[(3-methylphenyl)methyl]phenyl]carbazole |
| SMILES | Cc1cccc(Cc2ccc(-n3c4ccc(C(C)(C)C)cc4c4cc(C(C)(C)C)ccc43)cc2)c1 |
| InChI | InChI=1S/C34H37N/c1-23-9-8-10-25(19-23)20-24-11-15-28(16-12-24)35-31-17-13-26(33(2,3)4)21-29(31)30-22-27(34(5,6)7)14-18-32(30)35/h8-19,21-22H,20H2,1-7H3 |
| InChIKey | USMXIVNIWWGYKA-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |