About (5S)-5-fluoro-5-methyl-1,3-diazepine
(5S)-5-fluoro-5-methyl-1,3-diazepine (PubChem CID 145348431) has the molecular formula C6H7FN2
and a molecular weight of 126.13 g/mol. Its IUPAC name is (5S)-5-fluoro-5-methyl-1,3-diazepine.
Molecular Properties
| Compound Name | (5S)-5-fluoro-5-methyl-1,3-diazepine |
| PubChem CID | 145348431 |
| Molecular Formula | C6H7FN2 |
| Molecular Weight | 126.13 g/mol |
| Exact Mass | 126.06 |
| IUPAC Name | (5S)-5-fluoro-5-methyl-1,3-diazepine |
| SMILES | C[C@]1(F)C=CN=CN=C1 |
| InChI | InChI=1S/C6H7FN2/c1-6(7)2-3-8-5-9-4-6/h2-5H,1H3/t6-/m0/s1 |
| InChIKey | FZSMUCPGAVMNIH-LURJTMIESA-N |
| XLogP | 1.34 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.13 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-5-fluoro-5-methyl-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-fluoro-5-methyl-1,3-diazepine?
The IUPAC name of (5S)-5-fluoro-5-methyl-1,3-diazepine (CID 145348431) is (5S)-5-fluoro-5-methyl-1,3-diazepine.
What is the SMILES notation for (5S)-5-fluoro-5-methyl-1,3-diazepine?
The canonical SMILES for (5S)-5-fluoro-5-methyl-1,3-diazepine is C[C@]1(F)C=CN=CN=C1.
What is the InChIKey of (5S)-5-fluoro-5-methyl-1,3-diazepine?
The InChIKey is FZSMUCPGAVMNIH-LURJTMIESA-N. The full InChI is InChI=1S/C6H7FN2/c1-6(7)2-3-8-5-9-4-6/h2-5H,1H3/t6-/m0/s1.
What are the key properties of (5S)-5-fluoro-5-methyl-1,3-diazepine?
(5S)-5-fluoro-5-methyl-1,3-diazepine has a molecular weight of 126.13 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-fluoro-5-methyl-1,3-diazepine is sourced from PubChem (CID 145348431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).