C20H26B2O3 — CID 145348638
3,9-ditert-butyl-5,7-dihydroxybenzo[d][2,1,3]benzoxadiborepine (PubChem CID 145348638) has the molecular formula C20H26B2O3 and a molecular weight of 336.05 g/mol. Its IUPAC name is 3,9-ditert-butyl-5,7-dihydroxybenzo[d][2,1,3]benzoxadiborepine.
| Compound Name | 3,9-ditert-butyl-5,7-dihydroxybenzo[d][2,1,3]benzoxadiborepine |
|---|---|
| PubChem CID | 145348638 |
| Molecular Formula | C20H26B2O3 |
| Molecular Weight | 336.05 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 3,9-ditert-butyl-5,7-dihydroxybenzo[d][2,1,3]benzoxadiborepine |
| SMILES | CC(C)(C)c1ccc2c(c1)B(O)OB(O)c1cc(C(C)(C)C)ccc1-2 |
| InChI | InChI=1S/C20H26B2O3/c1-19(2,3)13-7-9-15-16-10-8-14(20(4,5)6)12-18(16)22(24)25-21(23)17(15)11-13/h7-12,23-24H,1-6H3 |
| InChIKey | RULUJXOQJAADGO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.05 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|