C22H27ClFNO4 — CID 145348995
5-chloro-4-(fluoromethoxy)-2-hydroxy-3-[(2E,4E)-5-[(1S,3E)-3-hydroxyimino-1-methylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-methylbenzaldehyde (PubChem CID 145348995) has the molecular formula C22H27ClFNO4 and a molecular weight of 423.91 g/mol. Its IUPAC name is 5-chloro-4-(fluoromethoxy)-2-hydroxy-3-[(2E,4E)-5-[(1S,3E)-3-hydroxyimino-1-methylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-methylbenzaldehyde.
| Compound Name | 5-chloro-4-(fluoromethoxy)-2-hydroxy-3-[(2E,4E)-5-[(1S,3E)-3-hydroxyimino-1-methylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-methylbenzaldehyde |
|---|---|
| PubChem CID | 145348995 |
| Molecular Formula | C22H27ClFNO4 |
| Molecular Weight | 423.91 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 5-chloro-4-(fluoromethoxy)-2-hydroxy-3-[(2E,4E)-5-[(1S,3E)-3-hydroxyimino-1-methylcyclohexyl]-3-methylpenta-2,4-dienyl]-6-methylbenzaldehyde |
| SMILES | CC(/C=C/[C@@]1(C)CCC/C(=N\O)C1)=C\Cc1c(O)c(C=O)c(C)c(Cl)c1OCF |
| InChI | InChI=1S/C22H27ClFNO4/c1-14(8-10-22(3)9-4-5-16(11-22)25-28)6-7-17-20(27)18(12-26)15(2)19(23)21(17)29-13-24/h6,8,10,12,27-28H,4-5,7,9,11,13H2,1-3H3/b10-8+,14-6+,25-16+/t22-/m1/s1 |
| InChIKey | ATLVNVQKPKBLIQ-OBJKBYSPSA-N |
| XLogP | 5.93 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.91 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|