C16H30N2O8 — CID 145349461
3-[2-[bis(2-carboxyethyl)amino]ethyl-(2-carboxyethyl)amino]propanoic acid;ethane (PubChem CID 145349461) has the molecular formula C16H30N2O8 and a molecular weight of 378.42 g/mol. Its IUPAC name is 3-[2-[bis(2-carboxyethyl)amino]ethyl-(2-carboxyethyl)amino]propanoic acid;ethane.
| Compound Name | 3-[2-[bis(2-carboxyethyl)amino]ethyl-(2-carboxyethyl)amino]propanoic acid;ethane |
|---|---|
| PubChem CID | 145349461 |
| Molecular Formula | C16H30N2O8 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 3-[2-[bis(2-carboxyethyl)amino]ethyl-(2-carboxyethyl)amino]propanoic acid;ethane |
| SMILES | CC.O=C(O)CCN(CCC(=O)O)CCN(CCC(=O)O)CCC(=O)O |
| InChI | InChI=1S/C14H24N2O8.C2H6/c17-11(18)1-5-15(6-2-12(19)20)9-10-16(7-3-13(21)22)8-4-14(23)24;1-2/h1-10H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24);1-2H3 |
| InChIKey | QELXTYGHDSULMT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |