C13H24FN — CID 145350547
(6Z)-5-fluoro-N,5-dimethyl-4-propylocta-1,6-dien-2-amine (PubChem CID 145350547) has the molecular formula C13H24FN and a molecular weight of 213.34 g/mol. Its IUPAC name is (6Z)-5-fluoro-N,5-dimethyl-4-propylocta-1,6-dien-2-amine.
| Compound Name | (6Z)-5-fluoro-N,5-dimethyl-4-propylocta-1,6-dien-2-amine |
|---|---|
| PubChem CID | 145350547 |
| Molecular Formula | C13H24FN |
| Molecular Weight | 213.34 g/mol |
| Exact Mass | 213.19 |
| IUPAC Name | (6Z)-5-fluoro-N,5-dimethyl-4-propylocta-1,6-dien-2-amine |
| SMILES | C=C(CC(CCC)C(C)(F)/C=C\C)NC |
| InChI | InChI=1S/C13H24FN/c1-6-8-12(10-11(3)15-5)13(4,14)9-7-2/h7,9,12,15H,3,6,8,10H2,1-2,4-5H3/b9-7- |
| InChIKey | OPJSMAFXEYSSKB-CLFYSBASSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.34 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|