C28H52 — CID 145350768
(8Z)-8-ethyl-3a,6,7-trimethyl-3-(5-methylhexyl)-7-propyl-2,3,4,5,6,10,11,11a-octahydro-1H-cyclopenta[10]annulene (PubChem CID 145350768) has the molecular formula C28H52 and a molecular weight of 388.72 g/mol. Its IUPAC name is (8Z)-8-ethyl-3a,6,7-trimethyl-3-(5-methylhexyl)-7-propyl-2,3,4,5,6,10,11,11a-octahydro-1H-cyclopenta[10]annulene.
| Compound Name | (8Z)-8-ethyl-3a,6,7-trimethyl-3-(5-methylhexyl)-7-propyl-2,3,4,5,6,10,11,11a-octahydro-1H-cyclopenta[10]annulene |
|---|---|
| PubChem CID | 145350768 |
| Molecular Formula | C28H52 |
| Molecular Weight | 388.72 g/mol |
| Exact Mass | 388.41 |
| IUPAC Name | (8Z)-8-ethyl-3a,6,7-trimethyl-3-(5-methylhexyl)-7-propyl-2,3,4,5,6,10,11,11a-octahydro-1H-cyclopenta[10]annulene |
| SMILES | CCCC1(C)/C(CC)=C\CCC2CCC(CCCCC(C)C)C2(C)CCC1C |
| InChI | InChI=1S/C28H52/c1-8-20-27(6)23(5)19-21-28(7)25(14-11-10-13-22(3)4)17-18-26(28)16-12-15-24(27)9-2/h15,22-23,25-26H,8-14,16-21H2,1-7H3/b24-15- |
| InChIKey | KGIOPDBQIWAOLH-IWIPYMOSSA-N |
| XLogP | 9.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.72 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|