About (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane
(2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane (PubChem CID 145351235) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane.
Molecular Properties
| Compound Name | (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane |
| PubChem CID | 145351235 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane |
| SMILES | C=C/C=c1/c(=O)cc(CN)n(C)/c1=C/C.CC |
| InChI | InChI=1S/C12H16N2O.C2H6/c1-4-6-10-11(5-2)14(3)9(8-13)7-12(10)15;1-2/h4-7H,1,8,13H2,2-3H3;1-2H3/b10-6+,11-5+; |
| InChIKey | RHLFQWFLKWPCJB-KVHHTJRESA-N |
| XLogP | 0.64 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane?
The IUPAC name of (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane (CID 145351235) is (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane.
What is the SMILES notation for (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane?
The canonical SMILES for (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane is C=C/C=c1/c(=O)cc(CN)n(C)/c1=C/C.CC.
What is the InChIKey of (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane?
The InChIKey is RHLFQWFLKWPCJB-KVHHTJRESA-N. The full InChI is InChI=1S/C12H16N2O.C2H6/c1-4-6-10-11(5-2)14(3)9(8-13)7-12(10)15;1-2/h4-7H,1,8,13H2,2-3H3;1-2H3/b10-6+,11-5+;.
What are the key properties of (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane?
(2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane has a molecular weight of 234.34 g/mol, XLogP of 0.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3E)-6-(aminomethyl)-2-ethylidene-1-methyl-3-prop-2-enylidenepyridin-4-one;ethane is sourced from PubChem (CID 145351235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).