C16H26FN — CID 145351260
2-[(4Z)-6-fluoro-2-methyl-3-methylidenehepta-4,6-dienyl]-1-propan-2-ylpyrrolidine (PubChem CID 145351260) has the molecular formula C16H26FN and a molecular weight of 251.39 g/mol. Its IUPAC name is 2-[(4Z)-6-fluoro-2-methyl-3-methylidenehepta-4,6-dienyl]-1-propan-2-ylpyrrolidine.
| Compound Name | 2-[(4Z)-6-fluoro-2-methyl-3-methylidenehepta-4,6-dienyl]-1-propan-2-ylpyrrolidine |
|---|---|
| PubChem CID | 145351260 |
| Molecular Formula | C16H26FN |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.20 |
| IUPAC Name | 2-[(4Z)-6-fluoro-2-methyl-3-methylidenehepta-4,6-dienyl]-1-propan-2-ylpyrrolidine |
| SMILES | C=C(F)/C=C\C(=C)C(C)CC1CCCN1C(C)C |
| InChI | InChI=1S/C16H26FN/c1-12(2)18-10-6-7-16(18)11-14(4)13(3)8-9-15(5)17/h8-9,12,14,16H,3,5-7,10-11H2,1-2,4H3/b9-8- |
| InChIKey | LJRHOZVXOSYADP-HJWRWDBZSA-N |
| XLogP | 4.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|