C21H22ClF5N8O — CID 145351483
4-chloro-2-[5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrazin-2-yl]amino]methyl]piperidine-1-carbonyl]-N'-(methyldiazenyl)benzenecarboximidamide (PubChem CID 145351483) has the molecular formula C21H22ClF5N8O and a molecular weight of 532.91 g/mol. Its IUPAC name is 4-chloro-2-[5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrazin-2-yl]amino]methyl]piperidine-1-carbonyl]-N'-(methyldiazenyl)benzenecarboximidamide.
| Compound Name | 4-chloro-2-[5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrazin-2-yl]amino]methyl]piperidine-1-carbonyl]-N'-(methyldiazenyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 145351483 |
| Molecular Formula | C21H22ClF5N8O |
| Molecular Weight | 532.91 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 4-chloro-2-[5,5-difluoro-3-methyl-2-[[[5-(trifluoromethyl)pyrazin-2-yl]amino]methyl]piperidine-1-carbonyl]-N'-(methyldiazenyl)benzenecarboximidamide |
| SMILES | C/N=N/N=C(\N)c1ccc(Cl)cc1C(=O)N1CC(F)(F)CC(C)C1CNc1cnc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C21H22ClF5N8O/c1-11-6-20(23,24)10-35(15(11)7-31-17-9-30-16(8-32-17)21(25,26)27)19(36)14-5-12(22)3-4-13(14)18(28)33-34-29-2/h3-5,8-9,11,15H,6-7,10H2,1-2H3,(H,31,32)(H2,28,29,33) |
| InChIKey | VQGWZQZHUKVBOP-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.91 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|