About acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde
acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde (PubChem CID 145351672) has the molecular formula C17H16FNO2
and a molecular weight of 285.32 g/mol. Its IUPAC name is acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde.
Molecular Properties
| Compound Name | acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde |
| PubChem CID | 145351672 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde |
| SMILES | C#C.C=O.COc1ccc(/C=N/c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C14H12FNO.C2H2.CH2O/c1-17-14-8-2-11(3-9-14)10-16-13-6-4-12(15)5-7-13;2*1-2/h2-10H,1H3;1-2H;1H2/b16-10+;; |
| InChIKey | YABXGIXRDBGBBO-CNSDMJOKSA-N |
| XLogP | 3.65 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde?
The IUPAC name of acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde (CID 145351672) is acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde.
What is the SMILES notation for acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde?
The canonical SMILES for acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde is C#C.C=O.COc1ccc(/C=N/c2ccc(F)cc2)cc1.
What is the InChIKey of acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde?
The InChIKey is YABXGIXRDBGBBO-CNSDMJOKSA-N. The full InChI is InChI=1S/C14H12FNO.C2H2.CH2O/c1-17-14-8-2-11(3-9-14)10-16-13-6-4-12(15)5-7-13;2*1-2/h2-10H,1H3;1-2H;1H2/b16-10+;;.
What are the key properties of acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde?
acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde has a molecular weight of 285.32 g/mol, XLogP of 3.65, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;N-(4-fluorophenyl)-1-(4-methoxyphenyl)methanimine;formaldehyde is sourced from PubChem (CID 145351672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).