C18H30O4 — CID 145351706
6,10-dihydroxy-7,10a-dimethyl-4-propan-2-yl-4,4a,5,6,6a,7,8,9,10,10b-decahydro-1H-benzo[f]isochromen-2-one (PubChem CID 145351706) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 6,10-dihydroxy-7,10a-dimethyl-4-propan-2-yl-4,4a,5,6,6a,7,8,9,10,10b-decahydro-1H-benzo[f]isochromen-2-one.
| Compound Name | 6,10-dihydroxy-7,10a-dimethyl-4-propan-2-yl-4,4a,5,6,6a,7,8,9,10,10b-decahydro-1H-benzo[f]isochromen-2-one |
|---|---|
| PubChem CID | 145351706 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 6,10-dihydroxy-7,10a-dimethyl-4-propan-2-yl-4,4a,5,6,6a,7,8,9,10,10b-decahydro-1H-benzo[f]isochromen-2-one |
| SMILES | CC(C)C1OC(=O)CC2C1CC(O)C1C(C)CCC(O)C21C |
| InChI | InChI=1S/C18H30O4/c1-9(2)17-11-7-13(19)16-10(3)5-6-14(20)18(16,4)12(11)8-15(21)22-17/h9-14,16-17,19-20H,5-8H2,1-4H3 |
| InChIKey | CNJASCNQPNQKIW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |