C35H44FNO3 — CID 145352152
6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(4-hexan-3-yloxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine;1-fluorobutane (PubChem CID 145352152) has the molecular formula C35H44FNO3 and a molecular weight of 545.74 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(4-hexan-3-yloxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine;1-fluorobutane.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(4-hexan-3-yloxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine;1-fluorobutane |
|---|---|
| PubChem CID | 145352152 |
| Molecular Formula | C35H44FNO3 |
| Molecular Weight | 545.74 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-(4-hexan-3-yloxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-2-amine;1-fluorobutane |
| SMILES | CCCC(CC)Oc1ccc(C2=C(c3ccc4c(c3)OCCO4)CCCc3cc(N)ccc32)cc1.CCCCF |
| InChI | InChI=1S/C31H35NO3.C4H9F/c1-3-6-25(4-2)35-26-13-9-21(10-14-26)31-27(8-5-7-22-19-24(32)12-15-28(22)31)23-11-16-29-30(20-23)34-18-17-33-29;1-2-3-4-5/h9-16,19-20,25H,3-8,17-18,32H2,1-2H3;2-4H2,1H3 |
| InChIKey | CGKQFTWGEYFVLV-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.74 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|