C14H22ClN3O — CID 145352443
1-(4-chloro-2,6-dimethylpyrimidin-5-yl)-N-methylmethanimine;2-methyloxane (PubChem CID 145352443) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is 1-(4-chloro-2,6-dimethylpyrimidin-5-yl)-N-methylmethanimine;2-methyloxane.
| Compound Name | 1-(4-chloro-2,6-dimethylpyrimidin-5-yl)-N-methylmethanimine;2-methyloxane |
|---|---|
| PubChem CID | 145352443 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 1-(4-chloro-2,6-dimethylpyrimidin-5-yl)-N-methylmethanimine;2-methyloxane |
| SMILES | C/N=C/c1c(C)nc(C)nc1Cl.CC1CCCCO1 |
| InChI | InChI=1S/C8H10ClN3.C6H12O/c1-5-7(4-10-3)8(9)12-6(2)11-5;1-6-4-2-3-5-7-6/h4H,1-3H3;6H,2-5H2,1H3/b10-4+; |
| InChIKey | QSHOKPUEVXIPKW-FCVRUTMISA-N |
| XLogP | 3.37 |
| TPSA | 47.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|