About 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine
1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine (PubChem CID 145352640) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine |
| PubChem CID | 145352640 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CCC(C1=CN=CCC1)N(C)C |
| InChI | InChI=1S/C10H18N2/c1-4-10(12(2)3)9-6-5-7-11-8-9/h7-8,10H,4-6H2,1-3H3 |
| InChIKey | HJOZQBKZSROOMP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine?
The IUPAC name of 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine (CID 145352640) is 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine is CCC(C1=CN=CCC1)N(C)C.
What is the InChIKey of 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine?
The InChIKey is HJOZQBKZSROOMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2/c1-4-10(12(2)3)9-6-5-7-11-8-9/h7-8,10H,4-6H2,1-3H3.
What are the key properties of 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine?
1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine has a molecular weight of 166.27 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-dihydropyridin-5-yl)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 145352640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).