C16H22F4N2O — CID 145352666
ethane;2-(4-fluorophenyl)-1-[4-methyl-3-(trifluoromethyl)piperazin-1-yl]ethanone (PubChem CID 145352666) has the molecular formula C16H22F4N2O and a molecular weight of 334.36 g/mol. Its IUPAC name is ethane;2-(4-fluorophenyl)-1-[4-methyl-3-(trifluoromethyl)piperazin-1-yl]ethanone.
| Compound Name | ethane;2-(4-fluorophenyl)-1-[4-methyl-3-(trifluoromethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 145352666 |
| Molecular Formula | C16H22F4N2O |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | ethane;2-(4-fluorophenyl)-1-[4-methyl-3-(trifluoromethyl)piperazin-1-yl]ethanone |
| SMILES | CC.CN1CCN(C(=O)Cc2ccc(F)cc2)CC1C(F)(F)F |
| InChI | InChI=1S/C14H16F4N2O.C2H6/c1-19-6-7-20(9-12(19)14(16,17)18)13(21)8-10-2-4-11(15)5-3-10;1-2/h2-5,12H,6-9H2,1H3;1-2H3 |
| InChIKey | IKGHPRJBOPFHBO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |