C22H27N5 — CID 145353700
5-(4-tert-butylphenyl)-11-(2-methylbutan-2-yl)-2,4,6,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7,11-pentaene (PubChem CID 145353700) has the molecular formula C22H27N5 and a molecular weight of 361.49 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-11-(2-methylbutan-2-yl)-2,4,6,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7,11-pentaene.
| Compound Name | 5-(4-tert-butylphenyl)-11-(2-methylbutan-2-yl)-2,4,6,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7,11-pentaene |
|---|---|
| PubChem CID | 145353700 |
| Molecular Formula | C22H27N5 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | 5-(4-tert-butylphenyl)-11-(2-methylbutan-2-yl)-2,4,6,10,12-pentazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7,11-pentaene |
| SMILES | CCC(C)(C)c1nc2nc3nc(-c4ccc(C(C)(C)C)cc4)[nH]c3cc2[nH]1 |
| InChI | InChI=1S/C22H27N5/c1-7-22(5,6)20-24-16-12-15-18(26-19(16)27-20)25-17(23-15)13-8-10-14(11-9-13)21(2,3)4/h8-12H,7H2,1-6H3,(H2,23,24,25,26,27) |
| InChIKey | PTSPQOBKSAUCKM-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |