C20H32N2O — CID 145353744
5-[(3Z,5E)-5-(4-methyl-3-propylhexoxy)hepta-1,3,5-trien-2-yl]-1H-pyrazole (PubChem CID 145353744) has the molecular formula C20H32N2O and a molecular weight of 316.49 g/mol. Its IUPAC name is 5-[(3Z,5E)-5-(4-methyl-3-propylhexoxy)hepta-1,3,5-trien-2-yl]-1H-pyrazole.
| Compound Name | 5-[(3Z,5E)-5-(4-methyl-3-propylhexoxy)hepta-1,3,5-trien-2-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 145353744 |
| Molecular Formula | C20H32N2O |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.25 |
| IUPAC Name | 5-[(3Z,5E)-5-(4-methyl-3-propylhexoxy)hepta-1,3,5-trien-2-yl]-1H-pyrazole |
| SMILES | C=C(/C=C\C(=C/C)OCCC(CCC)C(C)CC)c1ccn[nH]1 |
| InChI | InChI=1S/C20H32N2O/c1-6-9-18(16(4)7-2)13-15-23-19(8-3)11-10-17(5)20-12-14-21-22-20/h8,10-12,14,16,18H,5-7,9,13,15H2,1-4H3,(H,21,22)/b11-10-,19-8+ |
| InChIKey | UFYQYWGKMSFBIT-PXNCOTNSSA-N |
| XLogP | 5.75 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|