About 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene
1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene (PubChem CID 145354359) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene.
Molecular Properties
| Compound Name | 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene |
| PubChem CID | 145354359 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene |
| SMILES | C=C/C=C\C(=C)c1ccccc1CCC |
| InChI | InChI=1S/C15H18/c1-4-6-10-13(3)15-12-8-7-11-14(15)9-5-2/h4,6-8,10-12H,1,3,5,9H2,2H3/b10-6- |
| InChIKey | OIXMAJSOCUSNKH-POHAHGRESA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene?
The IUPAC name of 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene (CID 145354359) is 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene.
What is the SMILES notation for 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene?
The canonical SMILES for 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene is C=C/C=C\C(=C)c1ccccc1CCC.
What is the InChIKey of 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene?
The InChIKey is OIXMAJSOCUSNKH-POHAHGRESA-N. The full InChI is InChI=1S/C15H18/c1-4-6-10-13(3)15-12-8-7-11-14(15)9-5-2/h4,6-8,10-12H,1,3,5,9H2,2H3/b10-6-.
What are the key properties of 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene?
1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene has a molecular weight of 198.31 g/mol, XLogP of 4.39, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene is sourced from PubChem (CID 145354359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).