C15H18 — CID 145354359
1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene (PubChem CID 145354359) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene.
| Compound Name | 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene |
|---|---|
| PubChem CID | 145354359 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-[(3Z)-hexa-1,3,5-trien-2-yl]-2-propylbenzene |
| SMILES | C=C/C=C\C(=C)c1ccccc1CCC |
| InChI | InChI=1S/C15H18/c1-4-6-10-13(3)15-12-8-7-11-14(15)9-5-2/h4,6-8,10-12H,1,3,5,9H2,2H3/b10-6- |
| InChIKey | OIXMAJSOCUSNKH-POHAHGRESA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|