About 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid
2-sulfanyl-1,3-thiazolidine-4-carboxylic acid (PubChem CID 14535489) has the molecular formula C4H7NO2S2
and a molecular weight of 165.24 g/mol. Its IUPAC name is 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid |
| PubChem CID | 14535489 |
| Molecular Formula | C4H7NO2S2 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 164.99 |
| IUPAC Name | 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)C1CSC(S)N1 |
| InChI | InChI=1S/C4H7NO2S2/c6-3(7)2-1-9-4(8)5-2/h2,4-5,8H,1H2,(H,6,7) |
| InChIKey | FHTRVJPOBRWXTO-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid (CID 14535489) is 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid is O=C(O)C1CSC(S)N1.
What is the InChIKey of 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is FHTRVJPOBRWXTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2S2/c6-3(7)2-1-9-4(8)5-2/h2,4-5,8H,1H2,(H,6,7).
What are the key properties of 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid?
2-sulfanyl-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 165.24 g/mol, XLogP of -0.01, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyl-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 14535489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).