C29H40Cl2N2O2 — CID 145355598
butane;4-(3,5-dichlorophenyl)-1-[(E)-2-methylbut-2-enyl]piperidine;2-prop-1-en-2-ylpyridine-4-carboxylic acid (PubChem CID 145355598) has the molecular formula C29H40Cl2N2O2 and a molecular weight of 519.56 g/mol. Its IUPAC name is butane;4-(3,5-dichlorophenyl)-1-[(E)-2-methylbut-2-enyl]piperidine;2-prop-1-en-2-ylpyridine-4-carboxylic acid.
| Compound Name | butane;4-(3,5-dichlorophenyl)-1-[(E)-2-methylbut-2-enyl]piperidine;2-prop-1-en-2-ylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 145355598 |
| Molecular Formula | C29H40Cl2N2O2 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | butane;4-(3,5-dichlorophenyl)-1-[(E)-2-methylbut-2-enyl]piperidine;2-prop-1-en-2-ylpyridine-4-carboxylic acid |
| SMILES | C/C=C(\C)CN1CCC(c2cc(Cl)cc(Cl)c2)CC1.C=C(C)c1cc(C(=O)O)ccn1.CCCC |
| InChI | InChI=1S/C16H21Cl2N.C9H9NO2.C4H10/c1-3-12(2)11-19-6-4-13(5-7-19)14-8-15(17)10-16(18)9-14;1-6(2)8-5-7(9(11)12)3-4-10-8;1-3-4-2/h3,8-10,13H,4-7,11H2,1-2H3;3-5H,1H2,2H3,(H,11,12);3-4H2,1-2H3/b12-3+;; |
| InChIKey | DQJBJZAQWYTNCY-VELGEHSVSA-N |
| XLogP | 8.76 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | 8.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|