C31H52N2O2 — CID 145355735
ethane;(4E,5Z)-4-ethylidene-N-[(E)-2-methylbut-2-enyl]-N-propylocta-5,7-dien-3-amine;2-prop-1-en-2-ylpyridine-4-carboxylic acid (PubChem CID 145355735) has the molecular formula C31H52N2O2 and a molecular weight of 484.77 g/mol. Its IUPAC name is ethane;(4E,5Z)-4-ethylidene-N-[(E)-2-methylbut-2-enyl]-N-propylocta-5,7-dien-3-amine;2-prop-1-en-2-ylpyridine-4-carboxylic acid.
| Compound Name | ethane;(4E,5Z)-4-ethylidene-N-[(E)-2-methylbut-2-enyl]-N-propylocta-5,7-dien-3-amine;2-prop-1-en-2-ylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 145355735 |
| Molecular Formula | C31H52N2O2 |
| Molecular Weight | 484.77 g/mol |
| Exact Mass | 484.40 |
| IUPAC Name | ethane;(4E,5Z)-4-ethylidene-N-[(E)-2-methylbut-2-enyl]-N-propylocta-5,7-dien-3-amine;2-prop-1-en-2-ylpyridine-4-carboxylic acid |
| SMILES | C=C(C)c1cc(C(=O)O)ccn1.C=C/C=C\C(=C/C)C(CC)N(CCC)C/C(C)=C/C.CC.CC |
| InChI | InChI=1S/C18H31N.C9H9NO2.2C2H6/c1-7-12-13-17(10-4)18(11-5)19(14-8-2)15-16(6)9-3;1-6(2)8-5-7(9(11)12)3-4-10-8;2*1-2/h7,9-10,12-13,18H,1,8,11,14-15H2,2-6H3;3-5H,1H2,2H3,(H,11,12);2*1-2H3/b13-12-,16-9+,17-10+;;; |
| InChIKey | PKHFZMAAUCBDFB-NFVZBLAQSA-N |
| XLogP | 9.00 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.77 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|