About methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene
methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene (PubChem CID 145355875) has the molecular formula C25H25ClN2O3
and a molecular weight of 436.94 g/mol. Its IUPAC name is methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene.
Molecular Properties
| Compound Name | methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene |
| PubChem CID | 145355875 |
| Molecular Formula | C25H25ClN2O3 |
| Molecular Weight | 436.94 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene |
| SMILES | COC(=O)C1N=C(c2ccccc2)OC1c1ccc(Cl)cc1CN.Cc1ccccc1 |
| InChI | InChI=1S/C18H17ClN2O3.C7H8/c1-23-18(22)15-16(14-8-7-13(19)9-12(14)10-20)24-17(21-15)11-5-3-2-4-6-11;1-7-5-3-2-4-6-7/h2-9,15-16H,10,20H2,1H3;2-6H,1H3 |
| InChIKey | RULXSHDPVQWSQR-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.94 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene?
The IUPAC name of methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene (CID 145355875) is methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene.
What is the SMILES notation for methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene?
The canonical SMILES for methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene is COC(=O)C1N=C(c2ccccc2)OC1c1ccc(Cl)cc1CN.Cc1ccccc1.
What is the InChIKey of methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene?
The InChIKey is RULXSHDPVQWSQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17ClN2O3.C7H8/c1-23-18(22)15-16(14-8-7-13(19)9-12(14)10-20)24-17(21-15)11-5-3-2-4-6-11;1-7-5-3-2-4-6-7/h2-9,15-16H,10,20H2,1H3;2-6H,1H3.
What are the key properties of methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene?
methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene has a molecular weight of 436.94 g/mol, XLogP of 4.85, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[2-(aminomethyl)-4-chlorophenyl]-2-phenyl-4,5-dihydro-1,3-oxazole-4-carboxylate;toluene is sourced from PubChem (CID 145355875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).