C27H25N3O2S — CID 145355990
4-[5-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylethyl]-4-oxo-6,10b-dihydro-3aH-[1,3]oxazolo[4,5-d][2]benzazepin-2-yl]benzonitrile (PubChem CID 145355990) has the molecular formula C27H25N3O2S and a molecular weight of 455.58 g/mol. Its IUPAC name is 4-[5-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylethyl]-4-oxo-6,10b-dihydro-3aH-[1,3]oxazolo[4,5-d][2]benzazepin-2-yl]benzonitrile.
| Compound Name | 4-[5-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylethyl]-4-oxo-6,10b-dihydro-3aH-[1,3]oxazolo[4,5-d][2]benzazepin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 145355990 |
| Molecular Formula | C27H25N3O2S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 4-[5-[2-[(3E,5Z)-hepta-1,3,5-trien-4-yl]sulfanylethyl]-4-oxo-6,10b-dihydro-3aH-[1,3]oxazolo[4,5-d][2]benzazepin-2-yl]benzonitrile |
| SMILES | C=C/C=C(\C=C/C)SCCN1Cc2ccccc2C2OC(c3ccc(C#N)cc3)=NC2C1=O |
| InChI | InChI=1S/C27H25N3O2S/c1-3-7-22(8-4-2)33-16-15-30-18-21-9-5-6-10-23(21)25-24(27(30)31)29-26(32-25)20-13-11-19(17-28)12-14-20/h3-14,24-25H,1,15-16,18H2,2H3/b8-4-,22-7+ |
| InChIKey | APSZZDQWCRPDEZ-WRXUCBFUSA-N |
| XLogP | 5.17 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|