About disodium;benzene-1,3-dicarboxylate
disodium;benzene-1,3-dicarboxylate (PubChem CID 14535627) has the molecular formula C8H4Na2O4
and a molecular weight of 210.10 g/mol. Its IUPAC name is disodium;benzene-1,3-dicarboxylate.
Molecular Properties
| Compound Name | disodium;benzene-1,3-dicarboxylate |
| PubChem CID | 14535627 |
| Molecular Formula | C8H4Na2O4 |
| Molecular Weight | 210.10 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | disodium;benzene-1,3-dicarboxylate |
| SMILES | O=C([O-])c1cccc(C(=O)[O-])c1.[Na+].[Na+] |
| InChI | InChI=1S/C8H6O4.2Na/c9-7(10)5-2-1-3-6(4-5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;/q;2*+1/p-2 |
| InChIKey | GZCKIUIIYCBICZ-UHFFFAOYSA-L |
| XLogP | -7.58 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.10 |
| LogP ≤ 5 | -7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze disodium;benzene-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;benzene-1,3-dicarboxylate?
The IUPAC name of disodium;benzene-1,3-dicarboxylate (CID 14535627) is disodium;benzene-1,3-dicarboxylate.
What is the SMILES notation for disodium;benzene-1,3-dicarboxylate?
The canonical SMILES for disodium;benzene-1,3-dicarboxylate is O=C([O-])c1cccc(C(=O)[O-])c1.[Na+].[Na+].
What is the InChIKey of disodium;benzene-1,3-dicarboxylate?
The InChIKey is GZCKIUIIYCBICZ-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H6O4.2Na/c9-7(10)5-2-1-3-6(4-5)8(11)12;;/h1-4H,(H,9,10)(H,11,12);;/q;2*+1/p-2.
What are the key properties of disodium;benzene-1,3-dicarboxylate?
disodium;benzene-1,3-dicarboxylate has a molecular weight of 210.10 g/mol, XLogP of -7.58, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;benzene-1,3-dicarboxylate is sourced from PubChem (CID 14535627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).