About 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol
1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol (PubChem CID 145356535) has the molecular formula C22H28N2S
and a molecular weight of 352.55 g/mol. Its IUPAC name is 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol.
Molecular Properties
| Compound Name | 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol |
| PubChem CID | 145356535 |
| Molecular Formula | C22H28N2S |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol |
| SMILES | C1=c2ccccc2=NC2CC12.CC.CC(C)/C=N/c1ccccc1S |
| InChI | InChI=1S/C10H13NS.C10H9N.C2H6/c1-8(2)7-11-9-5-3-4-6-10(9)12;1-2-4-9-7(3-1)5-8-6-10(8)11-9;1-2/h3-8,12H,1-2H3;1-5,8,10H,6H2;1-2H3/b11-7+;; |
| InChIKey | IJKMDZDTRWQNQP-FCVAESPPSA-N |
| XLogP | 4.85 |
| TPSA | 24.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol?
The IUPAC name of 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol (CID 145356535) is 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol.
What is the SMILES notation for 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol?
The canonical SMILES for 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol is C1=c2ccccc2=NC2CC12.CC.CC(C)/C=N/c1ccccc1S.
What is the InChIKey of 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol?
The InChIKey is IJKMDZDTRWQNQP-FCVAESPPSA-N. The full InChI is InChI=1S/C10H13NS.C10H9N.C2H6/c1-8(2)7-11-9-5-3-4-6-10(9)12;1-2-4-9-7(3-1)5-8-6-10(8)11-9;1-2/h3-8,12H,1-2H3;1-5,8,10H,6H2;1-2H3/b11-7+;;.
What are the key properties of 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol?
1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol has a molecular weight of 352.55 g/mol, XLogP of 4.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1a,7a-dihydro-1H-cyclopropa[b]quinoline;ethane;2-(2-methylpropylideneamino)benzenethiol is sourced from PubChem (CID 145356535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).