C35H53N3O3 — CID 145357325
4-(1-aminoethenyl)-2-(3,3-dimethylbut-1-ynyl)-N-[4-(methoxymethyl)phenyl]-5-methyl-1-(1-methylcyclopropyl)pyrrole-3-carboxamide;prop-1-ene;1-propoxypropane (PubChem CID 145357325) has the molecular formula C35H53N3O3 and a molecular weight of 563.83 g/mol. Its IUPAC name is 4-(1-aminoethenyl)-2-(3,3-dimethylbut-1-ynyl)-N-[4-(methoxymethyl)phenyl]-5-methyl-1-(1-methylcyclopropyl)pyrrole-3-carboxamide;prop-1-ene;1-propoxypropane.
| Compound Name | 4-(1-aminoethenyl)-2-(3,3-dimethylbut-1-ynyl)-N-[4-(methoxymethyl)phenyl]-5-methyl-1-(1-methylcyclopropyl)pyrrole-3-carboxamide;prop-1-ene;1-propoxypropane |
|---|---|
| PubChem CID | 145357325 |
| Molecular Formula | C35H53N3O3 |
| Molecular Weight | 563.83 g/mol |
| Exact Mass | 563.41 |
| IUPAC Name | 4-(1-aminoethenyl)-2-(3,3-dimethylbut-1-ynyl)-N-[4-(methoxymethyl)phenyl]-5-methyl-1-(1-methylcyclopropyl)pyrrole-3-carboxamide;prop-1-ene;1-propoxypropane |
| SMILES | C=C(N)c1c(C(=O)Nc2ccc(COC)cc2)c(C#CC(C)(C)C)n(C2(C)CC2)c1C.C=CC.CCCOCCC |
| InChI | InChI=1S/C26H33N3O2.C6H14O.C3H6/c1-17(27)22-18(2)29(26(6)14-15-26)21(12-13-25(3,4)5)23(22)24(30)28-20-10-8-19(9-11-20)16-31-7;1-3-5-7-6-4-2;1-3-2/h8-11H,1,14-16,27H2,2-7H3,(H,28,30);3-6H2,1-2H3;3H,1H2,2H3 |
| InChIKey | IAIKMMDCLBZUHC-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.83 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|