C31H36FN3O5 — CID 145357657
(3R,3aR,6aR)-3-propyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-fluoro-5-[4-[5-(2-methoxyethoxy)-2-pyridinyl]phenyl]-2-methyl-1H-pyrrolo[3,2-b]pyridine (PubChem CID 145357657) has the molecular formula C31H36FN3O5 and a molecular weight of 549.64 g/mol. Its IUPAC name is (3R,3aR,6aR)-3-propyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-fluoro-5-[4-[5-(2-methoxyethoxy)-2-pyridinyl]phenyl]-2-methyl-1H-pyrrolo[3,2-b]pyridine.
| Compound Name | (3R,3aR,6aR)-3-propyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-fluoro-5-[4-[5-(2-methoxyethoxy)-2-pyridinyl]phenyl]-2-methyl-1H-pyrrolo[3,2-b]pyridine |
|---|---|
| PubChem CID | 145357657 |
| Molecular Formula | C31H36FN3O5 |
| Molecular Weight | 549.64 g/mol |
| Exact Mass | 549.26 |
| IUPAC Name | (3R,3aR,6aR)-3-propyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-ol;6-fluoro-5-[4-[5-(2-methoxyethoxy)-2-pyridinyl]phenyl]-2-methyl-1H-pyrrolo[3,2-b]pyridine |
| SMILES | CCC[C@@H]1CO[C@@H]2C(O)CO[C@H]12.COCCOc1ccc(-c2ccc(-c3nc4cc(C)[nH]c4cc3F)cc2)nc1 |
| InChI | InChI=1S/C22H20FN3O2.C9H16O3/c1-14-11-20-21(25-14)12-18(23)22(26-20)16-5-3-15(4-6-16)19-8-7-17(13-24-19)28-10-9-27-2;1-2-3-6-4-11-9-7(10)5-12-8(6)9/h3-8,11-13,25H,9-10H2,1-2H3;6-10H,2-5H2,1H3/t;6-,7?,8-,9-/m.1/s1 |
| InChIKey | HDYONFFQIVGUKP-KFOJTDMXSA-N |
| XLogP | 5.33 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.64 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|