C25H27N — CID 145357962
4-[4-[(3E)-hepta-1,3-dien-3-yl]cyclohexa-2,4-dien-1-yl]-2-methyl-6-phenylpyridine (PubChem CID 145357962) has the molecular formula C25H27N and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-[4-[(3E)-hepta-1,3-dien-3-yl]cyclohexa-2,4-dien-1-yl]-2-methyl-6-phenylpyridine.
| Compound Name | 4-[4-[(3E)-hepta-1,3-dien-3-yl]cyclohexa-2,4-dien-1-yl]-2-methyl-6-phenylpyridine |
|---|---|
| PubChem CID | 145357962 |
| Molecular Formula | C25H27N |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 4-[4-[(3E)-hepta-1,3-dien-3-yl]cyclohexa-2,4-dien-1-yl]-2-methyl-6-phenylpyridine |
| SMILES | C=C/C(=C\CCC)C1=CCC(c2cc(C)nc(-c3ccccc3)c2)C=C1 |
| InChI | InChI=1S/C25H27N/c1-4-6-10-20(5-2)21-13-15-22(16-14-21)24-17-19(3)26-25(18-24)23-11-8-7-9-12-23/h5,7-15,17-18,22H,2,4,6,16H2,1,3H3/b20-10+ |
| InChIKey | RATZFNXNORWGQS-KEBDBYFISA-N |
| XLogP | 6.94 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|