C25H48N4O — CID 145358549
methanamine;3-[(6S,9S)-5,8,9-triamino-6-ethyl-10,13-dimethyl-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propanal (PubChem CID 145358549) has the molecular formula C25H48N4O and a molecular weight of 420.69 g/mol. Its IUPAC name is methanamine;3-[(6S,9S)-5,8,9-triamino-6-ethyl-10,13-dimethyl-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propanal.
| Compound Name | methanamine;3-[(6S,9S)-5,8,9-triamino-6-ethyl-10,13-dimethyl-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propanal |
|---|---|
| PubChem CID | 145358549 |
| Molecular Formula | C25H48N4O |
| Molecular Weight | 420.69 g/mol |
| Exact Mass | 420.38 |
| IUPAC Name | methanamine;3-[(6S,9S)-5,8,9-triamino-6-ethyl-10,13-dimethyl-1,2,3,4,6,7,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]propanal |
| SMILES | CC[C@H]1CC2(N)C3CCC(CCC=O)C3(C)CC[C@]2(N)C2(C)CCCCC12N.CN |
| InChI | InChI=1S/C24H43N3O.CH5N/c1-4-17-16-23(26)19-10-9-18(8-7-15-28)20(19,2)13-14-24(23,27)21(3)11-5-6-12-22(17,21)25;1-2/h15,17-19H,4-14,16,25-27H2,1-3H3;2H2,1H3/t17-,18?,19?,20?,21?,22?,23?,24-;/m0./s1 |
| InChIKey | JDYNEUCAWNHBPC-LEMQXEQLSA-N |
| XLogP | 3.47 |
| TPSA | 121.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.69 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|