C16H27NO — CID 145358935
ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one (PubChem CID 145358935) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one.
| Compound Name | ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 145358935 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one |
| SMILES | CC.CC.Cc1ccc(C(C)C)c2c1CNC2=O |
| InChI | InChI=1S/C12H15NO.2C2H6/c1-7(2)9-5-4-8(3)10-6-13-12(14)11(9)10;2*1-2/h4-5,7H,6H2,1-3H3,(H,13,14);2*1-2H3 |
| InChIKey | JITRIVGWYYMAFI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |