About ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one
ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one (PubChem CID 145358935) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one |
| PubChem CID | 145358935 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one |
| SMILES | CC.CC.Cc1ccc(C(C)C)c2c1CNC2=O |
| InChI | InChI=1S/C12H15NO.2C2H6/c1-7(2)9-5-4-8(3)10-6-13-12(14)11(9)10;2*1-2/h4-5,7H,6H2,1-3H3,(H,13,14);2*1-2H3 |
| InChIKey | JITRIVGWYYMAFI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one?
The IUPAC name of ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one (CID 145358935) is ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one.
What is the SMILES notation for ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one?
The canonical SMILES for ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one is CC.CC.Cc1ccc(C(C)C)c2c1CNC2=O.
What is the InChIKey of ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one?
The InChIKey is JITRIVGWYYMAFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO.2C2H6/c1-7(2)9-5-4-8(3)10-6-13-12(14)11(9)10;2*1-2/h4-5,7H,6H2,1-3H3,(H,13,14);2*1-2H3.
What are the key properties of ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one?
ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one has a molecular weight of 249.40 g/mol, XLogP of 4.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-7-propan-2-yl-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 145358935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).