About 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine
5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine (PubChem CID 145359037) has the molecular formula C23H24F2N2O
and a molecular weight of 382.45 g/mol. Its IUPAC name is 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine.
Molecular Properties
| Compound Name | 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine |
| PubChem CID | 145359037 |
| Molecular Formula | C23H24F2N2O |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.19 |
| IUPAC Name | 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine |
| SMILES | NCCCC(N)COc1cc(-c2ccc(F)cc2)cc(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C23H24F2N2O/c24-20-7-3-16(4-8-20)18-12-19(17-5-9-21(25)10-6-17)14-23(13-18)28-15-22(27)2-1-11-26/h3-10,12-14,22H,1-2,11,15,26-27H2 |
| InChIKey | PZLFXSJNMRVUEK-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine?
The IUPAC name of 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine (CID 145359037) is 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine.
What is the SMILES notation for 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine?
The canonical SMILES for 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine is NCCCC(N)COc1cc(-c2ccc(F)cc2)cc(-c2ccc(F)cc2)c1.
What is the InChIKey of 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine?
The InChIKey is PZLFXSJNMRVUEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24F2N2O/c24-20-7-3-16(4-8-20)18-12-19(17-5-9-21(25)10-6-17)14-23(13-18)28-15-22(27)2-1-11-26/h3-10,12-14,22H,1-2,11,15,26-27H2.
What are the key properties of 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine?
5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine has a molecular weight of 382.45 g/mol, XLogP of 4.74, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3,5-bis(4-fluorophenyl)phenoxy]pentane-1,4-diamine is sourced from PubChem (CID 145359037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).