C7H11NO — CID 145360200
4,5-dimethyl-1H-pyridin-2-one;molecular hydrogen (PubChem CID 145360200) has the molecular formula C7H11NO and a molecular weight of 125.17 g/mol. Its IUPAC name is 4,5-dimethyl-1H-pyridin-2-one;molecular hydrogen.
| Compound Name | 4,5-dimethyl-1H-pyridin-2-one;molecular hydrogen |
|---|---|
| PubChem CID | 145360200 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | 4,5-dimethyl-1H-pyridin-2-one;molecular hydrogen |
| SMILES | Cc1c[nH]c(=O)cc1C.[H][H] |
| InChI | InChI=1S/C7H9NO.H2/c1-5-3-7(9)8-4-6(5)2;/h3-4H,1-2H3,(H,8,9);1H |
| InChIKey | ZSPLOAYBMPYRQI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |