C22H25N7O3S2 — CID 145360465
2,9-dimethyl-13-[4-(4-methylpiperazin-1-yl)sulfonylanilino]-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one (PubChem CID 145360465) has the molecular formula C22H25N7O3S2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 2,9-dimethyl-13-[4-(4-methylpiperazin-1-yl)sulfonylanilino]-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one.
| Compound Name | 2,9-dimethyl-13-[4-(4-methylpiperazin-1-yl)sulfonylanilino]-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
|---|---|
| PubChem CID | 145360465 |
| Molecular Formula | C22H25N7O3S2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 2,9-dimethyl-13-[4-(4-methylpiperazin-1-yl)sulfonylanilino]-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-8-one |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(Nc3ncc4c(n3)N(C)c3ccsc3C(=O)N4C)cc2)CC1 |
| InChI | InChI=1S/C22H25N7O3S2/c1-26-9-11-29(12-10-26)34(31,32)16-6-4-15(5-7-16)24-22-23-14-18-20(25-22)27(2)17-8-13-33-19(17)21(30)28(18)3/h4-8,13-14H,9-12H2,1-3H3,(H,23,24,25) |
| InChIKey | FSUNRWJLRSFJCG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |