C23H19N5O4S2 — CID 145360468
phenyl 4-[(2,9-dimethyl-8-oxo-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-13-yl)amino]benzenesulfonate (PubChem CID 145360468) has the molecular formula C23H19N5O4S2 and a molecular weight of 493.57 g/mol. Its IUPAC name is phenyl 4-[(2,9-dimethyl-8-oxo-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-13-yl)amino]benzenesulfonate.
| Compound Name | phenyl 4-[(2,9-dimethyl-8-oxo-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-13-yl)amino]benzenesulfonate |
|---|---|
| PubChem CID | 145360468 |
| Molecular Formula | C23H19N5O4S2 |
| Molecular Weight | 493.57 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | phenyl 4-[(2,9-dimethyl-8-oxo-6-thia-2,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(14),3(7),4,10,12-pentaen-13-yl)amino]benzenesulfonate |
| SMILES | CN1C(=O)c2sccc2N(C)c2nc(Nc3ccc(S(=O)(=O)Oc4ccccc4)cc3)ncc21 |
| InChI | InChI=1S/C23H19N5O4S2/c1-27-18-12-13-33-20(18)22(29)28(2)19-14-24-23(26-21(19)27)25-15-8-10-17(11-9-15)34(30,31)32-16-6-4-3-5-7-16/h3-14H,1-2H3,(H,24,25,26) |
| InChIKey | NZNXRUBGKORUCM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.57 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|