About (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate
(4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate (PubChem CID 14536090) has the molecular formula C19H24N2O2
and a molecular weight of 312.41 g/mol. Its IUPAC name is (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate.
Molecular Properties
| Compound Name | (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate |
| PubChem CID | 14536090 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate |
| SMILES | Cn1nc2c(c1C(=O)OCc1ccc(C(C)(C)C)cc1)CCC2 |
| InChI | InChI=1S/C19H24N2O2/c1-19(2,3)14-10-8-13(9-11-14)12-23-18(22)17-15-6-5-7-16(15)20-21(17)4/h8-11H,5-7,12H2,1-4H3 |
| InChIKey | JOVQXCSUIYEYJH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate?
The IUPAC name of (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate (CID 14536090) is (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate.
What is the SMILES notation for (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate?
The canonical SMILES for (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate is Cn1nc2c(c1C(=O)OCc1ccc(C(C)(C)C)cc1)CCC2.
What is the InChIKey of (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate?
The InChIKey is JOVQXCSUIYEYJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O2/c1-19(2,3)14-10-8-13(9-11-14)12-23-18(22)17-15-6-5-7-16(15)20-21(17)4/h8-11H,5-7,12H2,1-4H3.
What are the key properties of (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate?
(4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate has a molecular weight of 312.41 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl)methyl 2-methyl-5,6-dihydro-4H-cyclopenta[c]pyrazole-3-carboxylate is sourced from PubChem (CID 14536090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).