About 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine
6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine (PubChem CID 145361154) has the molecular formula C10H16F2N4
and a molecular weight of 230.26 g/mol. Its IUPAC name is 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine.
Molecular Properties
| Compound Name | 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine |
| PubChem CID | 145361154 |
| Molecular Formula | C10H16F2N4 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine |
| SMILES | Cc1cc(CN)nnc1N(CCF)CCF |
| InChI | InChI=1S/C10H16F2N4/c1-8-6-9(7-13)14-15-10(8)16(4-2-11)5-3-12/h6H,2-5,7,13H2,1H3 |
| InChIKey | VXCLNWFDRQGOMN-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine?
The IUPAC name of 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine (CID 145361154) is 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine.
What is the SMILES notation for 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine?
The canonical SMILES for 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine is Cc1cc(CN)nnc1N(CCF)CCF.
What is the InChIKey of 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine?
The InChIKey is VXCLNWFDRQGOMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F2N4/c1-8-6-9(7-13)14-15-10(8)16(4-2-11)5-3-12/h6H,2-5,7,13H2,1H3.
What are the key properties of 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine?
6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine has a molecular weight of 230.26 g/mol, XLogP of 0.99, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(aminomethyl)-N,N-bis(2-fluoroethyl)-4-methylpyridazin-3-amine is sourced from PubChem (CID 145361154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).