About benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate
benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate (PubChem CID 145361376) has the molecular formula C18H16ClF2NO4
and a molecular weight of 383.78 g/mol. Its IUPAC name is benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate.
Molecular Properties
| Compound Name | benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate |
| PubChem CID | 145361376 |
| Molecular Formula | C18H16ClF2NO4 |
| Molecular Weight | 383.78 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate |
| SMILES | O=C(OCc1ccccc1)C(CO)NC(=O)C(F)(F)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H16ClF2NO4/c19-14-8-4-7-13(9-14)18(20,21)17(25)22-15(10-23)16(24)26-11-12-5-2-1-3-6-12/h1-9,15,23H,10-11H2,(H,22,25) |
| InChIKey | XSCOTMASTUTJDW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.78 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate?
The IUPAC name of benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate (CID 145361376) is benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate.
What is the SMILES notation for benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate?
The canonical SMILES for benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate is O=C(OCc1ccccc1)C(CO)NC(=O)C(F)(F)c1cccc(Cl)c1.
What is the InChIKey of benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate?
The InChIKey is XSCOTMASTUTJDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClF2NO4/c19-14-8-4-7-13(9-14)18(20,21)17(25)22-15(10-23)16(24)26-11-12-5-2-1-3-6-12/h1-9,15,23H,10-11H2,(H,22,25).
What are the key properties of benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate?
benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate has a molecular weight of 383.78 g/mol, XLogP of 2.65, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-[[2-(3-chlorophenyl)-2,2-difluoroacetyl]amino]-3-hydroxypropanoate is sourced from PubChem (CID 145361376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).