C12H22N4O — CID 145361444
2,4,4,6-tetramethyl-6-(2H-tetrazol-5-yl)heptan-3-one (PubChem CID 145361444) has the molecular formula C12H22N4O and a molecular weight of 238.33 g/mol. Its IUPAC name is 2,4,4,6-tetramethyl-6-(2H-tetrazol-5-yl)heptan-3-one.
| Compound Name | 2,4,4,6-tetramethyl-6-(2H-tetrazol-5-yl)heptan-3-one |
|---|---|
| PubChem CID | 145361444 |
| Molecular Formula | C12H22N4O |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | 2,4,4,6-tetramethyl-6-(2H-tetrazol-5-yl)heptan-3-one |
| SMILES | CC(C)C(=O)C(C)(C)CC(C)(C)c1nn[nH]n1 |
| InChI | InChI=1S/C12H22N4O/c1-8(2)9(17)11(3,4)7-12(5,6)10-13-15-16-14-10/h8H,7H2,1-6H3,(H,13,14,15,16) |
| InChIKey | OWIHTYQEFITJJY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |