About 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen
3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen (PubChem CID 145361554) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen.
Molecular Properties
| Compound Name | 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen |
| PubChem CID | 145361554 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen |
| SMILES | CC1CC2(CCN(C#N)C2)C(=O)N1.[H][H] |
| InChI | InChI=1S/C9H13N3O.H2/c1-7-4-9(8(13)11-7)2-3-12(5-9)6-10;/h7H,2-5H2,1H3,(H,11,13);1H |
| InChIKey | KWKLBNLWNUMXLJ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen?
The IUPAC name of 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen (CID 145361554) is 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen.
What is the SMILES notation for 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen?
The canonical SMILES for 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen is CC1CC2(CCN(C#N)C2)C(=O)N1.[H][H].
What is the InChIKey of 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen?
The InChIKey is KWKLBNLWNUMXLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O.H2/c1-7-4-9(8(13)11-7)2-3-12(5-9)6-10;/h7H,2-5H2,1H3,(H,11,13);1H.
What are the key properties of 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen?
3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen has a molecular weight of 181.24 g/mol, XLogP of 0.31, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-oxo-2,7-diazaspiro[4.4]nonane-7-carbonitrile;molecular hydrogen is sourced from PubChem (CID 145361554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).