C16H16F3NO4S — CID 145362670
[(2,2-dimethyl-7,8-dihydro-3H-benzo[f]chromen-1-ylidene)amino] trifluoromethanesulfonate (PubChem CID 145362670) has the molecular formula C16H16F3NO4S and a molecular weight of 375.37 g/mol. Its IUPAC name is [(2,2-dimethyl-7,8-dihydro-3H-benzo[f]chromen-1-ylidene)amino] trifluoromethanesulfonate.
| Compound Name | [(2,2-dimethyl-7,8-dihydro-3H-benzo[f]chromen-1-ylidene)amino] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 145362670 |
| Molecular Formula | C16H16F3NO4S |
| Molecular Weight | 375.37 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | [(2,2-dimethyl-7,8-dihydro-3H-benzo[f]chromen-1-ylidene)amino] trifluoromethanesulfonate |
| SMILES | CC1(C)COc2ccc3c(c2C1=NOS(=O)(=O)C(F)(F)F)C=CCC3 |
| InChI | InChI=1S/C16H16F3NO4S/c1-15(2)9-23-12-8-7-10-5-3-4-6-11(10)13(12)14(15)20-24-25(21,22)16(17,18)19/h4,6-8H,3,5,9H2,1-2H3 |
| InChIKey | PPJNTHNTQSBTCB-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|