About (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate
(11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate (PubChem CID 145362822) has the molecular formula C25H34O5S
and a molecular weight of 446.61 g/mol. Its IUPAC name is (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate.
Molecular Properties
| Compound Name | (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate |
| PubChem CID | 145362822 |
| Molecular Formula | C25H34O5S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate |
| SMILES | C=CC1CCC2C3CCCC12CCCCC3OC(=O)COS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C25H34O5S/c1-3-19-11-14-22-21-7-6-16-25(19,22)15-5-4-8-23(21)30-24(26)17-29-31(27,28)20-12-9-18(2)10-13-20/h3,9-10,12-13,19,21-23H,1,4-8,11,14-17H2,2H3 |
| InChIKey | UIRYIEWIVOKLDE-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate?
The IUPAC name of (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate (CID 145362822) is (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate.
What is the SMILES notation for (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate?
The canonical SMILES for (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate is C=CC1CCC2C3CCCC12CCCCC3OC(=O)COS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate?
The InChIKey is UIRYIEWIVOKLDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H34O5S/c1-3-19-11-14-22-21-7-6-16-25(19,22)15-5-4-8-23(21)30-24(26)17-29-31(27,28)20-12-9-18(2)10-13-20/h3,9-10,12-13,19,21-23H,1,4-8,11,14-17H2,2H3.
What are the key properties of (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate?
(11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate has a molecular weight of 446.61 g/mol, XLogP of 5.18, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (11-ethenyl-6-tricyclo[5.4.3.01,8]tetradecanyl) 2-(4-methylphenyl)sulfonyloxyacetate is sourced from PubChem (CID 145362822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).